On Target NTRK1_HUMAN 0.3716216/CHEMBL3666420
For the given ligand DS-245, we have found in our database that, being scored 0.3716216, the most similar ligand is CHEMBL3666420. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3666420 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CC(C)c1csc(n1)C(=O)Nc2cncc(c2)C(=O)c3cn(C(C)C)c4ncncc34 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 08024082 01a05800 42084900 50040e38 0c0e5000 0810c002 00002080 0101800d 00400100 400800d0 20298a2c 50010000 00008890 00b00021 00422081 100c010c 01079000 828010ac 08600410 40004645 c4101000 988486f0 21802040 50d1001c 03143002 ac100403 08200410 50001084 20400284 04461003 e0004200 200106a0 |