On Target MTOR_HUMAN 0.36307693/CHEMBL2334767
For the given ligand DS-245, we have found in our database that, being scored 0.36307693, the most similar ligand is CHEMBL2334767. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL2334767 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCNC(=O)Nc1ccc(cc1)c2nc3[C@H]4CC[C@@H](Cc3c(n2)N5CCOC[C@@H]5C)N4C(C)(C)C(=O)NC |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 1001800e 01000820 c0103102 dd8d0e10 050001a0 08104052 0140b004 28083941 10d00980 100908d0 203da004 4081b800 0e009082 0030a800 80021468 000c010c 11048a08 06406022 88402018 40600201 45320520 3827a610 33826041 12500118 10147400 c0000601 08004008 900010a1 0c08830e 00e60c03 6002d880 200062e0 |