On Target OPRX_HUMAN 0.38247013/CHEMBL511373
For the given ligand DS-245, we have found in our database that, being scored 0.38247013, the most similar ligand is CHEMBL511373. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL511373 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | OC1(CC2CCC(C1)N2C(c3ccccc3Cl)c4ccccc4Cl)c5cncs5 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00028002 01000100 00100102 00810614 00080300 00000010 020020a0 23009008 00400900 804808c0 08200a00 50018800 02000806 00800800 00402400 000c000c 00000000 02000080 00c02010 80004201 00002c00 18088190 21100080 10510014 02042001 ee000204 00000001 d0001384 000a0182 0006000a ac060000 00032610 |