On Target FYN_HUMAN 0.3263473/CHEMBL3622137
For the given ligand DS-245, we have found in our database that, being scored 0.3263473, the most similar ligand is CHEMBL3622137. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL3622137 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CCn1c(cc2c1nc(Nc3nc(C)c(C)s3)c4ncn(C)c24)C(=O)N(C5CC5)C6CC6 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 0003000a 42829800 00184981 18090e30 210c0060 0010e000 0040b180 1a02b809 00404700 400000d4 01298a0c 50019800 0400980a 01f00001 000e2cc0 021c010c 08858800 12004086 88600010 b0a21200 c0000001 1c0fa6f0 21806845 9071011c 42151082 cc000400 002084c0 b0010484 0372810c 044e2841 e00c0200 042166c2 |