On Target CAH2_HUMAN 0.36802974/CHEMBL50045
For the given ligand DS-245, we have found in our database that, being scored 0.36802974, the most similar ligand is CHEMBL50045. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL50045 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | NS(=O)(=O)c1cc(ccc1Cl)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 04008012 00807801 01104100 05b10610 040003e0 00010000 00002020 2200100c 01400980 00094ac0 2020a000 7000b800 06008846 00102801 813a0480 000c010c 10000000 0e000000 00010018 40002201 a0000c00 38228f00 23000000 1a40001c 00043000 c0080200 00040000 90000108 0c000104 20460009 e0044000 60030220 |