On Target ESR1_HUMAN 0.34732825/CHEMBL434502
For the given ligand DS-245, we have found in our database that, being scored 0.34732825, the most similar ligand is CHEMBL434502. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL434502 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CN(CCCc1ccc(Cl)cc1)c2nc(NCCc3ccc(O)cc3)nc(n2)N4CCN(Cc5csc(C)n5)CC4 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00038002 00002209 20100904 14010e00 02000002 00100002 02000080 0011b889 00000900 000908c0 08310a00 50009800 06000036 00002001 00022400 101c000c 00001000 020040a2 00000010 00228001 00000100 3a221180 60004020 83410014 02003000 8c008800 00360000 90001044 0c00001c 0446100a 80001000 00030601 |