On Target MIF_HUMAN 0.22027972/CHEMBL554271
For the given ligand DS-245, we have found in our database that, being scored 0.22027972, the most similar ligand is CHEMBL554271. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL554271 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | Oc1ccc(cc1F)C2=NOC(CCN3C(=O)c4ccccc4C3=O)C2 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 00000000 01801808 20900102 12050e00 02000000 10048010 020000c0 22003000 00108948 000828c1 08310000 50018000 80008802 00201000 00000408 00090018 00002800 02000000 00d06000 00820601 80020100 38168690 010010c2 0050001c 00000001 c0220004 e0124000 92000001 0018c10a 00068003 e00c0000 00000600 |