On Target IKKB_HUMAN 0.31111112/CHEMBL492755
For the given ligand DS-245, we have found in our database that, being scored 0.31111112, the most similar ligand is CHEMBL492755. Check out the elaboration below.
| DS-245 (Given Ligand) | CHEMBL492755 (Similar Ligand) |
|---|---|
| CCCC(NC(=O)C(CCSC)NC(=O)c1cc(Cl)cc(Cl)c1)c3nc2CCCCc2s3 | CNc1nc2sc(nc2c3c1ncn3C)C(=O)NCc4cccs4 |
|
|
|
|
|
|
| 0002800a 09003900 02100902 15910e54 18000100 02120022 074030a0 2a01f00f 84400800 004948d8 00218a00 d004b820 060188d6 08243c21 84422400 00040304 04009200 060000a6 00202018 80004a41 44101800 f88f8780 20004309 52c1001c 02143000 cc010401 00200a00 90003184 080a0304 04861825 a8044080 21032210 | 000300ca 11802000 0a084918 10080e28 101c0060 0011d000 0000b180 0201f019 10c00100 000010c0 01298a0c 50020080 080098b2 01110020 000e3580 020c050c 09141000 0200508e 08600010 84a0000c d0001000 dc0c86e0 2180e8c5 30610008 02102002 cc010000 40388480 80000084 28028b0c 00461801 40000000 00c14ec0 |