On Target PERM_HUMAN 0.14117648/CHEMBL2347026
For the given ligand Polygodial, we have found in our database that, being scored 0.14117648, the most similar ligand is CHEMBL2347026. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL2347026 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | NC(=O)CCCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00010002 01000800 00100102 42810610 00041100 00000030 00002000 00000000 00400800 000808c0 08100004 40019000 0c008808 00601800 00000040 00040005 00000000 02000080 00202400 00100001 40000100 18008618 20800000 80400010 00042000 80000000 08000000 00000001 00000002 00078002 00040200 00000620 |