On Target PDE5A_HUMAN 0.10714286/CHEMBL190423
For the given ligand Polygodial, we have found in our database that, being scored 0.10714286, the most similar ligand is CHEMBL190423. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL190423 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 04010001 01001808 20100109 00010600 00081001 80024000 52040000 22001200 00000100 00080ac0 48200000 40019000 0480880a 00810000 01000401 0a082008 00000000 02008000 00402000 40020a01 00000000 18068e30 01000000 00d0101c 00004000 c0002000 08120000 90800000 00010300 00060003 e0060004 00000600 |