On Target AMPN_HUMAN 0.37142858/CHEMBL27519
For the given ligand Polygodial, we have found in our database that, being scored 0.37142858, the most similar ligand is CHEMBL27519. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL27519 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | NC(CS)CC1CCCC(C1)C(=O)O |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00010000 01000000 00000000 00100400 00080000 00000000 00000000 00000000 00200000 00000080 00000000 40031000 04008008 00840000 00000000 00080008 00000000 00000000 02402000 00000001 00000000 10000a10 01000100 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 03010000 |