On Target DRD2_HUMAN 0.21311475/CHEMBL309623
For the given ligand Polygodial, we have found in our database that, being scored 0.21311475, the most similar ligand is CHEMBL309623. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL309623 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | O=C(N[C@@H]1CC[C@@H](CCN2CCN(CC2)c3ccccc3)CC1)C4CCCCC4 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00014002 01001000 00100020 04000600 00000000 00000000 00000000 20000000 00000000 00000ac0 00200004 40019000 0400800a 00002000 00000040 00000000 00040000 00000000 0a002000 00000201 40100000 38040610 20000021 0210001a 00000000 00000000 00000000 10000080 08008000 00060001 00020000 00002200 |