On Target NOS1_HUMAN 0.19565217/CHEMBL11471
For the given ligand Polygodial, we have found in our database that, being scored 0.19565217, the most similar ligand is CHEMBL11471. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL11471 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | CC(=N)NCCC[C@H](N)C(=O)O |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00010000 01000000 00100000 00000400 00080000 00000000 00000000 20000000 00200200 00000083 00200000 40033000 04008012 01000000 00000000 00180008 00000000 00000000 00400000 00000201 00000000 10000a00 03000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 80000000 00000200 |