On Target CNR1_HUMAN 0.26086956/CHEMBL483143
For the given ligand Polygodial, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL483143. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL483143 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | CCCCCCCCCCCCCCCC(=O)N[C@H]1C[C@H]1O |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00010000 01005000 00100000 00000400 00000080 00000000 00000000 20000000 00000000 00000080 00200000 40011000 0400800a 01000000 00080000 00080008 10000000 00000000 00802000 00000201 00000000 10100610 03000080 00100018 00000001 00000000 00000000 10000000 00000000 00040001 00020000 00002200 |