On Target NTRK1_HUMAN 0.13/CHEMBL1978371
For the given ligand Polygodial, we have found in our database that, being scored 0.13, the most similar ligand is CHEMBL1978371. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL1978371 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | Clc1ccc(cc1)C2CC(=C(C#N)C(=O)C2C(=O)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00018000 01000800 00000302 00110620 00000000 00080000 90000080 00000402 01800900 00188842 08100000 40029800 0602802c 00200000 00000403 00020000 00400400 02000020 0001a008 02000001 00000100 18020380 00008420 00400014 01202802 80002000 00446100 c0000000 00480002 80060002 a4020000 00030480 |