On Target ESR1_HUMAN 0.2826087/CHEMBL2103774
For the given ligand Polygodial, we have found in our database that, being scored 0.2826087, the most similar ligand is CHEMBL2103774. Check out the elaboration below.
| Polygodial (Given Ligand) | CHEMBL2103774 (Similar Ligand) |
|---|---|
| CC(=O)C2CCC1C(CCC[C@]1(C)C)C2C(C)=O | C[C@@H]1CC2=C(CCC(=O)C2)[C@H]3CC[C@@]4(C)[C@@H](CC[C@@]4(O)C#C)[C@H]13 |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000200 00000000 00000010 00000000 00000000 00000000 00000000 00000002 00000000 00020000 00000000 | 00010000 01000000 00800000 00000000 00482000 00000000 00000040 00000402 00000040 00100000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02402000 02000001 00000008 00000200 01008000 00000010 00200000 00000000 00404000 80000000 00000000 81000200 24020800 00000000 |