On Target TRPV1_RAT 0.3548387/CHEMBL2057859
For the given ligand test, we have found in our database that, being scored 0.3548387, the most similar ligand is CHEMBL2057859. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2057859 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CCCCCCCC\C=C\CCCCCCCC(=O)NC(C)c1ccc(O)c(OC)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00010000 47800008 20100108 00010600 00001000 00000000 02000000 22001402 00000000 001808c0 08200000 40019000 0402c80a 20000000 01000401 00008008 00000000 02000000 00082000 00020201 80000000 18008610 00008000 00548018 00200000 c0000000 00724000 90000000 00000300 00060003 24060000 00000600 |