On Target MK01_HUMAN 0.32098764/CHEMBL1909070
For the given ligand test, we have found in our database that, being scored 0.32098764, the most similar ligand is CHEMBL1909070. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1909070 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CC(C)(Oc1ccc(cc1)C2CCCc3ccccc23)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 04000000 01000008 2000010a 00010200 00001000 00000002 02040400 01000001 00000800 00080840 08140000 4000d000 00808002 00200000 01200001 00080008 00000200 82000000 00102000 00020001 00000100 08000a00 05004000 08400010 00000000 a0000001 00120008 40800000 02000282 00020002 00000000 00000400 |