On Target ADRB2_HUMAN 0.3529412/CHEMBL1524289
For the given ligand test, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL1524289. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1524289 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | Oc1ccc(CC2(CCCCC2)NC(=O)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 01001808 20100102 00010600 00000000 00000000 02000000 22001004 00000880 000808c0 08300000 40018000 00008802 00200000 00000400 00000008 00000000 02000000 02002000 00020201 00000100 18268610 00000000 8150001c 00000000 c0000000 00120000 90000000 04000102 00060003 a0060000 00000600 |