On Target PPARG_HUMAN 0.5068493/CHEMBL75133
For the given ligand test, we have found in our database that, being scored 0.5068493, the most similar ligand is CHEMBL75133. Check out the elaboration below.
| test (Given Ligand) | CHEMBL75133 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | C\C(=C/C(=O)O)\C=C\[C@@H]1C[C@]1(C)c2ccc3c(c2)C(C)(C)CCC3(C)C |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 01040000 00000102 00110200 40000001 00000003 00000000 00000403 01000900 00180842 08100000 40008800 00028000 21220000 00000400 0008000c 00000200 02000000 00092090 00000001 00000100 08000a00 0140c000 00400012 00201000 80002001 00404000 80800000 00000002 00020002 04000000 00010400 |