On Target CHLE_HUMAN 0.4390244/CHEMBL3586200
For the given ligand test, we have found in our database that, being scored 0.4390244, the most similar ligand is CHEMBL3586200. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3586200 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | C[C@@]12CC[C@@H]3[C@](C)(CC[C@H](OC(=O)CCc4ccc(O)cc4)[C@]3(C)C(=O)O)[C@H]1CC[C@H]5C(=CC[C@H]6[C@@](C)(CO)[C@H](O)CC[C@]56C)C2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00010040 01000008 20000100 00010300 000c0040 00200000 02000000 00000402 00000800 01180848 08100000 40009000 1402800a 00800000 00000400 00081008 00820000 02000020 03402008 00020001 00000120 08000a00 01008040 00400010 00200c00 80000000 0052c000 80001000 00000200 0002000a 24020000 00000400 |