On Target HPGDS_HUMAN 0.21176471/CHEMBL1743209
For the given ligand test, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL1743209. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1743209 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](C\C=C/CCCC(=O)O)C2CC1OO2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00010000 81040000 00000800 00000000 00280000 00080001 00000000 28000402 00000000 00108008 00000200 40001000 04128000 00800080 00000404 00080028 00100800 00000010 21402010 00002001 01004000 20020a00 01008000 00000010 00201000 00000400 00424204 80001000 00000000 01000000 24020001 00000000 |