On Target ALDR_HUMAN 0.2753623/CHEMBL77283
For the given ligand test, we have found in our database that, being scored 0.2753623, the most similar ligand is CHEMBL77283. Check out the elaboration below.
| test (Given Ligand) | CHEMBL77283 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | OC(=O)Cc1cc(O)c2C(=O)c3ccccc3C=Cc2c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 42000008 20000100 00010200 00000041 00000020 02000000 00000400 02000000 40080840 08000000 40009000 01008002 00200000 40040000 00080008 08000000 02000000 00000000 00220200 00000000 08000a08 01000000 00500010 00000000 80000000 00000080 00010000 00000000 00020002 00002000 00000400 |