On Target CNR1_HUMAN 0.59090906/CHEMBL57840
For the given ligand test, we have found in our database that, being scored 0.59090906, the most similar ligand is CHEMBL57840. Check out the elaboration below.
| test (Given Ligand) | CHEMBL57840 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CCCCCCC(C)(C)c1cc(O)c([C@@H]2C=C(C)C3C[C@H]2C3(C)C)c(O)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000001 43000008 20000102 00010202 00000000 40800000 02000001 00000602 00040900 00980840 08100000 40008840 00020002 00200010 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00024002 24020000 00000400 |