On Target P2Y12_HUMAN 0.24761905/CHEMBL420980
For the given ligand test, we have found in our database that, being scored 0.24761905, the most similar ligand is CHEMBL420980. Check out the elaboration below.
| test (Given Ligand) | CHEMBL420980 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | COC(=O)CCCCc1ccc2[nH]c3nc(O)nc3cc2c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00014002 03004810 00084102 00010300 000c0040 0000c000 00008000 00000000 00400900 00080840 08108004 40009000 04008808 00e00000 60040140 000c000c 08820000 02000004 00602000 00000001 40020100 08008a28 21800000 80400014 00000000 80000000 00028040 00000000 00400202 00420002 c0040000 0c000480 |