On Target SCN9A_HUMAN 0.35365853/CHEMBL381488
For the given ligand test, we have found in our database that, being scored 0.35365853, the most similar ligand is CHEMBL381488. Check out the elaboration below.
| test (Given Ligand) | CHEMBL381488 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | OC(CCc1ccccc1)[C@@H]2CCC[C@H]2COCc3ccc(OC(F)(F)F)cc3 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 01000008 2010010a 00010300 00281010 00004000 02040000 00000000 00000900 00080840 08100000 40408000 00000002 00a10000 01000001 02081008 00800000 02000000 10402000 00020001 00000120 08000020 01000048 00400010 00000400 80002000 004a0000 c0000000 02000202 01020002 40020000 02000600 |