On Target PRGR_HUMAN 0.5492958/CHEMBL50023
For the given ligand test, we have found in our database that, being scored 0.5492958, the most similar ligand is CHEMBL50023. Check out the elaboration below.
| test (Given Ligand) | CHEMBL50023 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CC1=CC(=C)C(Cc2ccc(cc2)[N+](=O)[O-])C(C)(C)C1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000002 01040810 00000102 40010200 40000000 00000001 00000000 00000402 14000800 00180862 0c100004 40008000 00030000 00200000 20100540 00000010 00000000 02000020 00002000 00000001 40020100 08000000 20008000 00400012 00200000 c0002000 00404200 80000010 01000002 00060002 24020000 04010400 |