On Target PGH2_HUMAN 0.49333334/CHEMBL2283180
For the given ligand test, we have found in our database that, being scored 0.49333334, the most similar ligand is CHEMBL2283180. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2283180 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CCCCCC\C(=C(/c1ccccc1)\c2ccc(cc2)N=[N+]=[N-])\c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000002 01000800 00000302 40010200 00004000 00000000 80000080 01000400 00000a00 00180840 08100104 40008000 00020000 00200000 00000443 00000000 00008400 02800000 00002000 00000001 44000100 18000000 20008032 00400010 01800002 a0000000 80406000 c0000000 00500082 00060002 24020000 00002400 |