On Target TRY1_HUMAN 0.40298507/CHEMBL102081
For the given ligand test, we have found in our database that, being scored 0.40298507, the most similar ligand is CHEMBL102081. Check out the elaboration below.
| test (Given Ligand) | CHEMBL102081 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | O=C1O[C@H]2CCC[C@@H]2[C@H]1Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00050040 01000008 00000102 00010300 00080000 00000000 00000000 00000000 00000800 00080840 08100000 40009000 04008008 00a00000 00080000 00081008 00820000 02000000 00402008 00000001 00000120 08000a00 01000040 00400010 00000c00 80000000 00000000 00000000 00000202 01020002 00020000 00000400 |