On Target ACE_HUMAN 0.28723404/CHEMBL86915
For the given ligand test, we have found in our database that, being scored 0.28723404, the most similar ligand is CHEMBL86915. Check out the elaboration below.
| test (Given Ligand) | CHEMBL86915 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | OC(=O)CN1CCCCCCC(NC(CCc2ccccc2)C(=O)O)C1=O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00010000 01005200 00100102 04010600 00080080 00000000 00000000 20000000 00000800 000808c0 08302000 4001b000 0600800a 00202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e10 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20024000 00402600 |