On Target OPRX_HUMAN 0.46666667/CHEMBL3959941
For the given ligand test, we have found in our database that, being scored 0.46666667, the most similar ligand is CHEMBL3959941. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3959941 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | CNC1(CCC(CC1)(N(C)C)c2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00300800 000808c0 08300000 40038000 00000800 00200000 00000000 00000000 00000000 02000000 02002000 00000001 00000100 18008010 00000000 00500010 00000000 80000000 00000000 90000000 00000102 00060002 00060000 00000600 |