On Target 5HT2B_HUMAN 0.48979592/CHEMBL452719
For the given ligand test, we have found in our database that, being scored 0.48979592, the most similar ligand is CHEMBL452719. Check out the elaboration below.
| test (Given Ligand) | CHEMBL452719 (Similar Ligand) |
|---|---|
| C/2=C/C(CCCCCCc1ccccc1)CCCCC2 | Cl.NC[C@H]1C[C@@H]1c2ccccc2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000402 00000800 00180840 08100000 40008000 00020000 00200000 00000400 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00008000 00400010 00200000 80000000 00404000 80000000 00000002 00020002 24020000 00000400 | 00000000 01000200 00000102 00010600 00000000 00000000 00000000 00000000 00100800 000808c0 08100000 40018000 00000000 01200000 00000000 00000000 00000000 02000000 00000000 00000001 00000100 18000000 00000000 00400010 00000000 80000000 00000000 00000000 00000000 0006000a 00000000 00020400 |