On Target PERM_HUMAN 0.39175257/CHEMBL3929246
For the given ligand mi, we have found in our database that, being scored 0.39175257, the most similar ligand is CHEMBL3929246. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL3929246 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Oc1ccccc1CNCCc2c[nH]c3ccc(F)cc23 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00000002 00000808 20100100 43010610 00041000 00000030 02002000 02001400 00400080 00190840 08200004 40008000 10000802 00401000 00000440 0004200d 00000000 02000080 00200400 00120200 40000000 18208008 20800000 91400010 00042000 c0000000 08000000 80000001 04000100 00078002 24040200 00000620 |