On Target PERM_HUMAN 0.30285713/CHEMBL3920217
For the given ligand pmi, we have found in our database that, being scored 0.30285713, the most similar ligand is CHEMBL3920217. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3920217 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | Oc1ccccc1CCCNCc2ccccc2O |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00000000 00000208 20100100 00010600 00000000 00000000 02000000 22001600 00000800 001808c0 08300000 40008040 00000802 00000000 00000400 00042008 00000000 02000000 00000000 00020201 00000100 18008000 00000000 00400010 00000000 c0000000 00000000 90000000 00000100 0006800a 24040000 00000600 |