On Target ACES_HUMAN 0.3857143/CHEMBL3417004
For the given ligand 7mi, we have found in our database that, being scored 0.3857143, the most similar ligand is CHEMBL3417004. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3417004 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1cc(N)c(Cl)cc1\C(=N\O)\CCC2CCN(CC3CCCCC3)CC2 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00008002 85000828 2090010a 40050e00 00401000 00000000 06000040 20002200 00100940 000808c1 08310004 50019840 02000006 08200000 81000041 00082018 08000000 02000400 02006000 00020601 40000100 18010110 20000000 00540410 00002000 c0000400 40100000 12000000 0004030a 00064402 400a0000 00022601 |