On Target TRPV1_RAT 0.52719665/CHEMBL3114906
For the given ligand pmi, we have found in our database that, being scored 0.52719665, the most similar ligand is CHEMBL3114906. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3114906 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CCOC(=O)[C@@H]1[C@H]2COc3c(F)cccc3[C@@H]2N[C@]1(C)C(=O)Nc4cc(C)ccc4C(=O)OC |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 1407c002 01000818 6010012a 46050700 24381000 02016150 02000000 22081600 00900900 00192ad0 08380084 5001b040 0e80883a 01393000 91020461 0208300a 00a60800 22008100 18c02010 00020201 40100160 38028e30 210020c1 02500516 40041401 c0002001 80000210 90001081 08508302 0006c003 e4044000 00c02e40 |