On Target PAR1_HUMAN 0.33783785/CHEMBL80942
For the given ligand 7mi, we have found in our database that, being scored 0.33783785, the most similar ligand is CHEMBL80942. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL80942 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | OC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2)c3ccc4OCOc4c3 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00010000 47801408 20100108 00010600 00001000 40000000 02040000 22001000 00200800 000809e0 48300000 50019000 0c00c81a 20000000 01000401 00288008 00000000 02000001 00c82018 00020201 80040300 181c8e30 010000c0 00548018 40001801 c0000000 00320000 b0000000 01000300 00060013 20040000 00012600 |