On Target PAR1_HUMAN 0.41666666/CHEMBL3658403
For the given ligand pmi, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL3658403. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3658403 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3(CC)COC3)C(=O)Nc4ccccc4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 01001400 00100102 00010700 20000000 00202000 00000000 20000004 00100980 000809e0 08380004 50019800 1c008012 00300000 00020040 00080008 10240000 02000001 08c00010 00000201 60100100 182c0620 21002080 81500018 00001001 80000000 00000000 10000080 04008200 00060013 00000000 00402600 |