On Target SC6A4_HUMAN 0.5477387/CHEMBL294481
For the given ligand mi, we have found in our database that, being scored 0.5477387, the most similar ligand is CHEMBL294481. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL294481 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccc2CN(CCc2c1)[C@@H]3CC[C@@H](CC3)c4c[nH]c5ccc(cc45)C#N |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0000000a 43000808 2010010a 50810610 00041120 80000000 02042000 22001000 00500980 008808c0 08300004 40818800 08000882 20600800 01000441 0004000c 00400200 02000024 02a82400 00020201 40020100 18208018 20804400 81500010 00042000 c0000000 08224440 90000000 04400302 00060402 20060200 00002620 |