On Target SC6A4_HUMAN 0.4972973/CHEMBL3233427
For the given ligand pmi, we have found in our database that, being scored 0.4972973, the most similar ligand is CHEMBL3233427. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3233427 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | Fc1ccc(cc1)C(=O)CCCN2CC[C@H]3[C@@H](C2)c4cccc5CCCN3c45 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00024002 01000e00 00100102 02010600 20001001 00002050 01000000 20000000 00100880 000809e0 08300004 50019000 04008002 00201000 00220140 000c000a 00048000 02000080 08000018 00100201 60100100 18220200 21000000 81500015 00001000 81000000 00000000 10801081 04088000 0006881a 80000080 20802600 |