On Target MK01_HUMAN 0.37630662/CHEMBL332551
For the given ligand 7mi, we have found in our database that, being scored 0.37630662, the most similar ligand is CHEMBL332551. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL332551 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Nc1nc(C2=C3C(=Nc4ccccc34)C(=O)NCC2)c(O)[nH]1 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00024042 09001218 40904380 02810e30 15200246 00040084 d30822f0 b8024602 42400960 011c28cb 2a338104 4100b840 14008102 40102900 820200c2 003cb00c 00000c00 0e000070 5000000c 40600a43 60020d00 18050601 e5209800 00411818 010c0800 8a100209 c0402401 50408b00 0049101c 00469c0b 44000001 2c002600 |