On Target MK01_HUMAN 0.50220263/CHEMBL3422092
For the given ligand mi, we have found in our database that, being scored 0.50220263, the most similar ligand is CHEMBL3422092. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL3422092 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | OC1C[C@@H]2CC[C@@H](C1)N2c3ccc(cc3)c4n[nH]c5ccc(cc45)C(=O)N[C@H](C6CC6)c7ccccn7 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0000600a 01809808 a0104102 50010e00 210c0020 00102012 03400000 22003001 00000900 000808c0 08318004 70818000 80008812 01e08000 00020440 020c210c 00262000 06000006 0ce02008 10220a01 c0100100 1c068618 31800880 0070401c 00100001 c0000000 10020040 900010e0 0000c104 00860003 a0060200 20006620 |