On Target MK01_HUMAN 0.40186915/CHEMBL3398606
For the given ligand pmi, we have found in our database that, being scored 0.40186915, the most similar ligand is CHEMBL3398606. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3398606 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | Oc1ccc(NC(=O)[C@@H]2CCN(CC(=O)N3CCN(CC3)c4ccc(cc4)c5ncccn5)C2)cc1C6CC6 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00024002 00002c08 60100120 14010600 24000020 00006010 02001000 20080208 00600900 10080bf0 08390004 4002b040 0e008022 0110a800 80020040 000c200c 00040000 02002000 08400010 00420201 64100100 38000600 20802063 0240001a 00041000 80000000 00040000 10000080 08408004 00460413 40004800 00800680 |