On Target HYES_HUMAN 0.39819005/CHEMBL482845
For the given ligand 7mi, we have found in our database that, being scored 0.39819005, the most similar ligand is CHEMBL482845. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL482845 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | O=C(NC1CCc2ccccc12)N3CCC4(CC3)CC(=O)c5ccccc5O4 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 04010008 01801a18 2010010a 10010f00 00001000 82220000 02000004 22003200 00000800 000808c0 09300000 50019060 14809892 00201000 11000081 000e2008 00204000 22008000 00c02040 00020201 80020100 18178610 010040e0 0050011c 00010003 c0000000 00000800 90000000 00000302 0006400b 800c0000 80000640 |