On Target HYES_HUMAN 0.4349776/CHEMBL1077963
For the given ligand mi, we have found in our database that, being scored 0.4349776, the most similar ligand is CHEMBL1077963. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL1077963 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | OC(=O)CCC1(CCCN(C1)C(=O)Nc2ccc(Cl)cc2)c3ccccn3 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0c01800e 01001000 00104122 10000e00 000c0020 00000000 01000004 2000200d 00100880 00080ac0 08388004 50819800 0600981e 01b00000 01020040 020c000c 00040008 0e400000 08602008 00000201 40200100 18258f10 21822000 81500018 00113000 80000000 00080040 10000080 04008004 00860003 000a0000 22c26e00 |