On Target HYES_HUMAN 0.4030612/CHEMBL3818537
For the given ligand pmi, we have found in our database that, being scored 0.4030612, the most similar ligand is CHEMBL3818537. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3818537 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CCOC(=O)C(CC)Cc1ccc(cc1)N2CCC(CC2)C(=O)NCc3ccccc3C(F)(F)F |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00024002 01800808 00100102 50010700 20000000 00002000 00000400 22001000 00200800 000808d0 08300004 50039000 04008802 01208000 000204c0 00081008 00060000 02000000 08402008 00000201 c4120120 18008e00 21000040 00500018 00000c00 c0000000 00004000 90000080 00008300 00060003 20160000 00800600 |