On Target AMPN_HUMAN 0.31716418/CHEMBL1077585
For the given ligand 7mi, we have found in our database that, being scored 0.31716418, the most similar ligand is CHEMBL1077585. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL1077585 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CCCC[C@@H](N)CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 0001800a 0180fe08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000909c0 08310004 4001b000 1e00888a 0060a801 801204c0 020c010c 10000200 02000006 00602408 00020a01 c0020100 38278e18 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186001b 20064200 00006620 |