On Target AOFA_HUMAN 0.47894737/CHEMBL4073457
For the given ligand pmi, we have found in our database that, being scored 0.47894737, the most similar ligand is CHEMBL4073457. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL4073457 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | O=C1CCc2ccc(OCCCCCCN3CCC(Cc4ccccc4)CC3)cc2N1 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 04004002 81000208 2010010a 00010700 30081000 06002040 02040000 20000000 00100800 000808c0 08380024 50019000 04808002 08b00000 11020041 000c2008 00848080 02000000 08402008 00022601 40100100 18000610 21002000 00500010 00000800 81000000 00120010 10001080 00008200 0006000b 00000000 20022600 |