On Target ADRB2_HUMAN 0.4155251/CHEMBL1814270
For the given ligand pmi, we have found in our database that, being scored 0.4155251, the most similar ligand is CHEMBL1814270. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL1814270 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCCCc2ccccc2N3C(=O)CNC3=O |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014046 01002008 20100122 00010f00 00081081 00004042 03000004 20002809 00000980 00080ac0 a8380024 4001a000 04008002 00b02000 000a0040 00083008 10a48000 02402020 08402008 40020241 40120120 38210630 23022000 8150001a 00100400 80000000 00520010 10001080 0c088200 00060003 60004080 20006600 |