On Target PPARG_HUMAN 0.540404/CHEMBL1836978
For the given ligand mi, we have found in our database that, being scored 0.540404, the most similar ligand is CHEMBL1836978. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL1836978 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccc2[nH]cc(CCNC(=O)[C@@]3(C)CC[C@]4(C)CC[C@]5(C)C(=CC(=O)[C@@H]6[C@@]7(C)CC[C@H](O)C(C)(C)[C@@H]7CC[C@@]56C)[C@@H]4C3)c2c1 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00010002 01001808 20100108 41010610 000c1000 00000000 060c2080 20000406 01400080 001988c0 08200004 40019000 1402880e 00c00000 01000441 000c000c 00000000 02000020 02612400 00020201 40000000 18208698 21808000 91500018 00242000 80000000 08524000 90000000 04000200 00060003 24060200 00002620 |